C31H32N2O4 — CID 91331992
benzyl 2-[[8-(4,4-dimethylpentan-2-yloxy)quinolin-2-yl]carbamoyl]benzoate (PubChem CID 91331992) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is benzyl 2-[[8-(4,4-dimethylpentan-2-yloxy)quinolin-2-yl]carbamoyl]benzoate.
| Compound Name | benzyl 2-[[8-(4,4-dimethylpentan-2-yloxy)quinolin-2-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 91331992 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | benzyl 2-[[8-(4,4-dimethylpentan-2-yloxy)quinolin-2-yl]carbamoyl]benzoate |
| SMILES | CC(CC(C)(C)C)Oc1cccc2ccc(NC(=O)c3ccccc3C(=O)OCc3ccccc3)nc12 |
| InChI | InChI=1S/C31H32N2O4/c1-21(19-31(2,3)4)37-26-16-10-13-23-17-18-27(32-28(23)26)33-29(34)24-14-8-9-15-25(24)30(35)36-20-22-11-6-5-7-12-22/h5-18,21H,19-20H2,1-4H3,(H,32,33,34) |
| InChIKey | QUVWXMXONDZTBF-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |