C22H17Cl2N5O2 — CID 91333473
4-[[(2S,8S)-2-azido-6-(3,5-dichlorophenyl)-7-methoxy-5-oxo-2,3-dihydro-1H-pyrrolizin-8-yl]methyl]benzonitrile (PubChem CID 91333473) has the molecular formula C22H17Cl2N5O2 and a molecular weight of 454.32 g/mol. Its IUPAC name is 4-[[(2S,8S)-2-azido-6-(3,5-dichlorophenyl)-7-methoxy-5-oxo-2,3-dihydro-1H-pyrrolizin-8-yl]methyl]benzonitrile.
| Compound Name | 4-[[(2S,8S)-2-azido-6-(3,5-dichlorophenyl)-7-methoxy-5-oxo-2,3-dihydro-1H-pyrrolizin-8-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 91333473 |
| Molecular Formula | C22H17Cl2N5O2 |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 4-[[(2S,8S)-2-azido-6-(3,5-dichlorophenyl)-7-methoxy-5-oxo-2,3-dihydro-1H-pyrrolizin-8-yl]methyl]benzonitrile |
| SMILES | COC1=C(c2cc(Cl)cc(Cl)c2)C(=O)N2C[C@@H](N=[N+]=[N-])C[C@@]12Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C22H17Cl2N5O2/c1-31-20-19(15-6-16(23)8-17(24)7-15)21(30)29-12-18(27-28-26)10-22(20,29)9-13-2-4-14(11-25)5-3-13/h2-8,18H,9-10,12H2,1H3/t18-,22-/m0/s1 |
| InChIKey | DBVYUKDJCABSAD-AVRDEDQJSA-N |
| XLogP | 5.13 |
| TPSA | 102.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|