C26H29Cl2FN4O3S2 — CID 91334466
[4-[4-[amino(cyclohexyl)carbamothioyl]-2-(2,4-dichlorophenyl)-5-methylimidazol-1-yl]phenyl] 3-fluoropropane-1-sulfonate (PubChem CID 91334466) has the molecular formula C26H29Cl2FN4O3S2 and a molecular weight of 599.58 g/mol. Its IUPAC name is [4-[4-[amino(cyclohexyl)carbamothioyl]-2-(2,4-dichlorophenyl)-5-methylimidazol-1-yl]phenyl] 3-fluoropropane-1-sulfonate.
| Compound Name | [4-[4-[amino(cyclohexyl)carbamothioyl]-2-(2,4-dichlorophenyl)-5-methylimidazol-1-yl]phenyl] 3-fluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 91334466 |
| Molecular Formula | C26H29Cl2FN4O3S2 |
| Molecular Weight | 599.58 g/mol |
| Exact Mass | 598.10 |
| IUPAC Name | [4-[4-[amino(cyclohexyl)carbamothioyl]-2-(2,4-dichlorophenyl)-5-methylimidazol-1-yl]phenyl] 3-fluoropropane-1-sulfonate |
| SMILES | Cc1c(C(=S)N(N)C2CCCCC2)nc(-c2ccc(Cl)cc2Cl)n1-c1ccc(OS(=O)(=O)CCCF)cc1 |
| InChI | InChI=1S/C26H29Cl2FN4O3S2/c1-17-24(26(37)33(30)20-6-3-2-4-7-20)31-25(22-13-8-18(27)16-23(22)28)32(17)19-9-11-21(12-10-19)36-38(34,35)15-5-14-29/h8-13,16,20H,2-7,14-15,30H2,1H3 |
| InChIKey | MUWLQAWVOOSFRN-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.58 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|