C28H26Cl2N4OS — CID 143259857
N-cyclohexyl-2-(2,4-dichlorophenyl)-1-[4-(3-isothiocyanatoprop-1-ynyl)phenyl]-N,5-dimethylimidazole-4-carboxamide (PubChem CID 143259857) has the molecular formula C28H26Cl2N4OS and a molecular weight of 537.52 g/mol. Its IUPAC name is N-cyclohexyl-2-(2,4-dichlorophenyl)-1-[4-(3-isothiocyanatoprop-1-ynyl)phenyl]-N,5-dimethylimidazole-4-carboxamide.
| Compound Name | N-cyclohexyl-2-(2,4-dichlorophenyl)-1-[4-(3-isothiocyanatoprop-1-ynyl)phenyl]-N,5-dimethylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 143259857 |
| Molecular Formula | C28H26Cl2N4OS |
| Molecular Weight | 537.52 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | N-cyclohexyl-2-(2,4-dichlorophenyl)-1-[4-(3-isothiocyanatoprop-1-ynyl)phenyl]-N,5-dimethylimidazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N(C)C2CCCCC2)nc(-c2ccc(Cl)cc2Cl)n1-c1ccc(C#CCN=C=S)cc1 |
| InChI | InChI=1S/C28H26Cl2N4OS/c1-19-26(28(35)33(2)22-8-4-3-5-9-22)32-27(24-15-12-21(29)17-25(24)30)34(19)23-13-10-20(11-14-23)7-6-16-31-18-36/h10-15,17,22H,3-5,8-9,16H2,1-2H3 |
| InChIKey | UUTYIWKSTSLYEK-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.52 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|