About ethane;N-phenylhex-4-ynamide
ethane;N-phenylhex-4-ynamide (PubChem CID 91335104) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is ethane;N-phenylhex-4-ynamide.
Molecular Properties
| Compound Name | ethane;N-phenylhex-4-ynamide |
| PubChem CID | 91335104 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | ethane;N-phenylhex-4-ynamide |
| SMILES | CC.CC#CCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H13NO.C2H6/c1-2-3-5-10-12(14)13-11-8-6-4-7-9-11;1-2/h4,6-9H,5,10H2,1H3,(H,13,14);1-2H3 |
| InChIKey | LOVNLHDMGTZAKU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-phenylhex-4-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-phenylhex-4-ynamide?
The IUPAC name of ethane;N-phenylhex-4-ynamide (CID 91335104) is ethane;N-phenylhex-4-ynamide.
What is the SMILES notation for ethane;N-phenylhex-4-ynamide?
The canonical SMILES for ethane;N-phenylhex-4-ynamide is CC.CC#CCCC(=O)Nc1ccccc1.
What is the InChIKey of ethane;N-phenylhex-4-ynamide?
The InChIKey is LOVNLHDMGTZAKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO.C2H6/c1-2-3-5-10-12(14)13-11-8-6-4-7-9-11;1-2/h4,6-9H,5,10H2,1H3,(H,13,14);1-2H3.
What are the key properties of ethane;N-phenylhex-4-ynamide?
ethane;N-phenylhex-4-ynamide has a molecular weight of 217.31 g/mol, XLogP of 3.45, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-phenylhex-4-ynamide is sourced from PubChem (CID 91335104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).