C28H27F4N5O6 — CID 91338214
N-[6-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]-N-[2-(2-methoxyethoxy)ethoxy]acetamide (PubChem CID 91338214) has the molecular formula C28H27F4N5O6 and a molecular weight of 605.55 g/mol. Its IUPAC name is N-[6-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]-N-[2-(2-methoxyethoxy)ethoxy]acetamide.
| Compound Name | N-[6-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]-N-[2-(2-methoxyethoxy)ethoxy]acetamide |
|---|---|
| PubChem CID | 91338214 |
| Molecular Formula | C28H27F4N5O6 |
| Molecular Weight | 605.55 g/mol |
| Exact Mass | 605.19 |
| IUPAC Name | N-[6-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]-N-[2-(2-methoxyethoxy)ethoxy]acetamide |
| SMILES | COCCOCCON(C(C)=O)c1nc2ccc(Oc3ccc(NC(=O)Nc4cc(C(F)(F)F)ccc4F)cc3)cc2[nH]1 |
| InChI | InChI=1S/C28H27F4N5O6/c1-17(38)37(42-14-13-41-12-11-40-2)26-34-23-10-8-21(16-25(23)35-26)43-20-6-4-19(5-7-20)33-27(39)36-24-15-18(28(30,31)32)3-9-22(24)29/h3-10,15-16H,11-14H2,1-2H3,(H,34,35)(H2,33,36,39) |
| InChIKey | QIURNZZBZIMMBN-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 127.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|