C21H41FO — CID 91338240
3,5,6,6-tetraethyl-8-fluoro-5,8-dimethyl-7-methylidenedecan-3-ol (PubChem CID 91338240) has the molecular formula C21H41FO and a molecular weight of 328.56 g/mol. Its IUPAC name is 3,5,6,6-tetraethyl-8-fluoro-5,8-dimethyl-7-methylidenedecan-3-ol.
| Compound Name | 3,5,6,6-tetraethyl-8-fluoro-5,8-dimethyl-7-methylidenedecan-3-ol |
|---|---|
| PubChem CID | 91338240 |
| Molecular Formula | C21H41FO |
| Molecular Weight | 328.56 g/mol |
| Exact Mass | 328.31 |
| IUPAC Name | 3,5,6,6-tetraethyl-8-fluoro-5,8-dimethyl-7-methylidenedecan-3-ol |
| SMILES | C=C(C(C)(F)CC)C(CC)(CC)C(C)(CC)CC(O)(CC)CC |
| InChI | InChI=1S/C21H41FO/c1-10-18(8,16-20(23,12-3)13-4)21(14-5,15-6)17(7)19(9,22)11-2/h23H,7,10-16H2,1-6,8-9H3 |
| InChIKey | LPDYQAWBULDYOZ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.56 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|