About ethylbenzene;3-fluoro-3-methylpent-1-en-2-ol
ethylbenzene;3-fluoro-3-methylpent-1-en-2-ol (PubChem CID 143236275) has the molecular formula C22H31FO
and a molecular weight of 330.49 g/mol. Its IUPAC name is ethylbenzene;3-fluoro-3-methylpent-1-en-2-ol.
Molecular Properties
| Compound Name | ethylbenzene;3-fluoro-3-methylpent-1-en-2-ol |
| PubChem CID | 143236275 |
| Molecular Formula | C22H31FO |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | ethylbenzene;3-fluoro-3-methylpent-1-en-2-ol |
| SMILES | C=C(O)C(C)(F)CC.CCc1ccccc1.CCc1ccccc1 |
| InChI | InChI=1S/2C8H10.C6H11FO/c2*1-2-8-6-4-3-5-7-8;1-4-6(3,7)5(2)8/h2*3-7H,2H2,1H3;8H,2,4H2,1,3H3 |
| InChIKey | QPTSJRGWOBUQMK-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethylbenzene;3-fluoro-3-methylpent-1-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylbenzene;3-fluoro-3-methylpent-1-en-2-ol?
The IUPAC name of ethylbenzene;3-fluoro-3-methylpent-1-en-2-ol (CID 143236275) is ethylbenzene;3-fluoro-3-methylpent-1-en-2-ol.
What is the SMILES notation for ethylbenzene;3-fluoro-3-methylpent-1-en-2-ol?
The canonical SMILES for ethylbenzene;3-fluoro-3-methylpent-1-en-2-ol is C=C(O)C(C)(F)CC.CCc1ccccc1.CCc1ccccc1.
What is the InChIKey of ethylbenzene;3-fluoro-3-methylpent-1-en-2-ol?
The InChIKey is QPTSJRGWOBUQMK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H10.C6H11FO/c2*1-2-8-6-4-3-5-7-8;1-4-6(3,7)5(2)8/h2*3-7H,2H2,1H3;8H,2,4H2,1,3H3.
What are the key properties of ethylbenzene;3-fluoro-3-methylpent-1-en-2-ol?
ethylbenzene;3-fluoro-3-methylpent-1-en-2-ol has a molecular weight of 330.49 g/mol, XLogP of 6.69, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylbenzene;3-fluoro-3-methylpent-1-en-2-ol is sourced from PubChem (CID 143236275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).