C25H22FIN4O3S2 — CID 91339098
3-benzyl-4-[2-[1-(4-fluorophenyl)ethylcarbamoyl]-5-(iodomethyl)-N-sulfinoanilino]-1,2,5-thiadiazole (PubChem CID 91339098) has the molecular formula C25H22FIN4O3S2 and a molecular weight of 636.51 g/mol. Its IUPAC name is 3-benzyl-4-[2-[1-(4-fluorophenyl)ethylcarbamoyl]-5-(iodomethyl)-N-sulfinoanilino]-1,2,5-thiadiazole.
| Compound Name | 3-benzyl-4-[2-[1-(4-fluorophenyl)ethylcarbamoyl]-5-(iodomethyl)-N-sulfinoanilino]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 91339098 |
| Molecular Formula | C25H22FIN4O3S2 |
| Molecular Weight | 636.51 g/mol |
| Exact Mass | 636.02 |
| IUPAC Name | 3-benzyl-4-[2-[1-(4-fluorophenyl)ethylcarbamoyl]-5-(iodomethyl)-N-sulfinoanilino]-1,2,5-thiadiazole |
| SMILES | CC(NC(=O)c1ccc(CI)cc1N(c1nsnc1Cc1ccccc1)S(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H22FIN4O3S2/c1-16(19-8-10-20(26)11-9-19)28-25(32)21-12-7-18(15-27)14-23(21)31(36(33)34)24-22(29-35-30-24)13-17-5-3-2-4-6-17/h2-12,14,16H,13,15H2,1H3,(H,28,32)(H,33,34) |
| InChIKey | DRQDBZLJLQAHQO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|