C24H21IN4O3S — CID 91242736
5-[5-(iodomethyl)-2-(1-phenylethylcarbamoyl)-N-sulfinoanilino]quinoxaline (PubChem CID 91242736) has the molecular formula C24H21IN4O3S and a molecular weight of 572.43 g/mol. Its IUPAC name is 5-[5-(iodomethyl)-2-(1-phenylethylcarbamoyl)-N-sulfinoanilino]quinoxaline.
| Compound Name | 5-[5-(iodomethyl)-2-(1-phenylethylcarbamoyl)-N-sulfinoanilino]quinoxaline |
|---|---|
| PubChem CID | 91242736 |
| Molecular Formula | C24H21IN4O3S |
| Molecular Weight | 572.43 g/mol |
| Exact Mass | 572.04 |
| IUPAC Name | 5-[5-(iodomethyl)-2-(1-phenylethylcarbamoyl)-N-sulfinoanilino]quinoxaline |
| SMILES | CC(NC(=O)c1ccc(CI)cc1N(c1cccc2nccnc12)S(=O)O)c1ccccc1 |
| InChI | InChI=1S/C24H21IN4O3S/c1-16(18-6-3-2-4-7-18)28-24(30)19-11-10-17(15-25)14-22(19)29(33(31)32)21-9-5-8-20-23(21)27-13-12-26-20/h2-14,16H,15H2,1H3,(H,28,30)(H,31,32) |
| InChIKey | KZZFECYOSWGMMB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|