C23H17FIN4O3S- — CID 91552019
5-[2-[(4-fluorophenyl)methylcarbamoyl]-5-(iodomethyl)-N-sulfinatoanilino]quinoxaline (PubChem CID 91552019) has the molecular formula C23H17FIN4O3S- and a molecular weight of 575.38 g/mol. Its IUPAC name is 5-[2-[(4-fluorophenyl)methylcarbamoyl]-5-(iodomethyl)-N-sulfinatoanilino]quinoxaline.
| Compound Name | 5-[2-[(4-fluorophenyl)methylcarbamoyl]-5-(iodomethyl)-N-sulfinatoanilino]quinoxaline |
|---|---|
| PubChem CID | 91552019 |
| Molecular Formula | C23H17FIN4O3S- |
| Molecular Weight | 575.38 g/mol |
| Exact Mass | 575.01 |
| IUPAC Name | 5-[2-[(4-fluorophenyl)methylcarbamoyl]-5-(iodomethyl)-N-sulfinatoanilino]quinoxaline |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccc(CI)cc1N(c1cccc2nccnc12)S(=O)[O-] |
| InChI | InChI=1S/C23H18FIN4O3S/c24-17-7-4-15(5-8-17)14-28-23(30)18-9-6-16(13-25)12-21(18)29(33(31)32)20-3-1-2-19-22(20)27-11-10-26-19/h1-12H,13-14H2,(H,28,30)(H,31,32)/p-1 |
| InChIKey | QLAZCKLARXODII-UHFFFAOYSA-M |
| XLogP | 4.57 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|