C22H14Cl3N4O3S- — CID 67200673
5-[5-chloro-2-[(2,4-dichlorophenyl)methylcarbamoyl]-N-sulfinatoanilino]quinoxaline (PubChem CID 67200673) has the molecular formula C22H14Cl3N4O3S- and a molecular weight of 520.81 g/mol. Its IUPAC name is 5-[5-chloro-2-[(2,4-dichlorophenyl)methylcarbamoyl]-N-sulfinatoanilino]quinoxaline.
| Compound Name | 5-[5-chloro-2-[(2,4-dichlorophenyl)methylcarbamoyl]-N-sulfinatoanilino]quinoxaline |
|---|---|
| PubChem CID | 67200673 |
| Molecular Formula | C22H14Cl3N4O3S- |
| Molecular Weight | 520.81 g/mol |
| Exact Mass | 518.99 |
| IUPAC Name | 5-[5-chloro-2-[(2,4-dichlorophenyl)methylcarbamoyl]-N-sulfinatoanilino]quinoxaline |
| SMILES | O=C(NCc1ccc(Cl)cc1Cl)c1ccc(Cl)cc1N(c1cccc2nccnc12)S(=O)[O-] |
| InChI | InChI=1S/C22H15Cl3N4O3S/c23-14-5-4-13(17(25)10-14)12-28-22(30)16-7-6-15(24)11-20(16)29(33(31)32)19-3-1-2-18-21(19)27-9-8-26-18/h1-11H,12H2,(H,28,30)(H,31,32)/p-1 |
| InChIKey | QNDIAOSZQAKFIP-UHFFFAOYSA-M |
| XLogP | 5.45 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.81 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|