C23H16F2IN4O3S- — CID 67201682
5-[2-[1-(2,4-difluorophenyl)ethylcarbamoyl]-5-iodo-N-sulfinatoanilino]quinoxaline (PubChem CID 67201682) has the molecular formula C23H16F2IN4O3S- and a molecular weight of 593.37 g/mol. Its IUPAC name is 5-[2-[1-(2,4-difluorophenyl)ethylcarbamoyl]-5-iodo-N-sulfinatoanilino]quinoxaline.
| Compound Name | 5-[2-[1-(2,4-difluorophenyl)ethylcarbamoyl]-5-iodo-N-sulfinatoanilino]quinoxaline |
|---|---|
| PubChem CID | 67201682 |
| Molecular Formula | C23H16F2IN4O3S- |
| Molecular Weight | 593.37 g/mol |
| Exact Mass | 593.00 |
| IUPAC Name | 5-[2-[1-(2,4-difluorophenyl)ethylcarbamoyl]-5-iodo-N-sulfinatoanilino]quinoxaline |
| SMILES | CC(NC(=O)c1ccc(I)cc1N(c1cccc2nccnc12)S(=O)[O-])c1ccc(F)cc1F |
| InChI | InChI=1S/C23H17F2IN4O3S/c1-13(16-7-5-14(24)11-18(16)25)29-23(31)17-8-6-15(26)12-21(17)30(34(32)33)20-4-2-3-19-22(20)28-10-9-27-19/h2-13H,1H3,(H,29,31)(H,32,33)/p-1 |
| InChIKey | XJPHSKDESNLJIA-UHFFFAOYSA-M |
| XLogP | 4.94 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|