C23H17ClIN4O3S- — CID 67200351
5-[2-[1-(4-chlorophenyl)ethylcarbamoyl]-5-iodo-N-sulfinatoanilino]quinoxaline (PubChem CID 67200351) has the molecular formula C23H17ClIN4O3S- and a molecular weight of 591.84 g/mol. Its IUPAC name is 5-[2-[1-(4-chlorophenyl)ethylcarbamoyl]-5-iodo-N-sulfinatoanilino]quinoxaline.
| Compound Name | 5-[2-[1-(4-chlorophenyl)ethylcarbamoyl]-5-iodo-N-sulfinatoanilino]quinoxaline |
|---|---|
| PubChem CID | 67200351 |
| Molecular Formula | C23H17ClIN4O3S- |
| Molecular Weight | 591.84 g/mol |
| Exact Mass | 590.98 |
| IUPAC Name | 5-[2-[1-(4-chlorophenyl)ethylcarbamoyl]-5-iodo-N-sulfinatoanilino]quinoxaline |
| SMILES | CC(NC(=O)c1ccc(I)cc1N(c1cccc2nccnc12)S(=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18ClIN4O3S/c1-14(15-5-7-16(24)8-6-15)28-23(30)18-10-9-17(25)13-21(18)29(33(31)32)20-4-2-3-19-22(20)27-12-11-26-19/h2-14H,1H3,(H,28,30)(H,31,32)/p-1 |
| InChIKey | MKQYHFRXQGXGNE-UHFFFAOYSA-M |
| XLogP | 5.31 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.84 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|