C20H18N4O — CID 91339578
2-benzyl-6-(4-methoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 91339578) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-benzyl-6-(4-methoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-benzyl-6-(4-methoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91339578 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-benzyl-6-(4-methoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(-c2cc3c(N)nc(Cc4ccccc4)nc3[nH]2)cc1 |
| InChI | InChI=1S/C20H18N4O/c1-25-15-9-7-14(8-10-15)17-12-16-19(21)23-18(24-20(16)22-17)11-13-5-3-2-4-6-13/h2-10,12H,11H2,1H3,(H3,21,22,23,24) |
| InChIKey | NIZOYDLQWAYJQH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |