C26H26ClN3O2 — CID 91341169
(6-chloro-3-pyridinyl)-[3-[(2-phenylphenyl)methyl]-1-oxa-3,8-diazaspiro[4.5]decan-8-yl]methanone (PubChem CID 91341169) has the molecular formula C26H26ClN3O2 and a molecular weight of 447.97 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)-[3-[(2-phenylphenyl)methyl]-1-oxa-3,8-diazaspiro[4.5]decan-8-yl]methanone.
| Compound Name | (6-chloro-3-pyridinyl)-[3-[(2-phenylphenyl)methyl]-1-oxa-3,8-diazaspiro[4.5]decan-8-yl]methanone |
|---|---|
| PubChem CID | 91341169 |
| Molecular Formula | C26H26ClN3O2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | (6-chloro-3-pyridinyl)-[3-[(2-phenylphenyl)methyl]-1-oxa-3,8-diazaspiro[4.5]decan-8-yl]methanone |
| SMILES | O=C(c1ccc(Cl)nc1)N1CCC2(CC1)CN(Cc1ccccc1-c1ccccc1)CO2 |
| InChI | InChI=1S/C26H26ClN3O2/c27-24-11-10-21(16-28-24)25(31)30-14-12-26(13-15-30)18-29(19-32-26)17-22-8-4-5-9-23(22)20-6-2-1-3-7-20/h1-11,16H,12-15,17-19H2 |
| InChIKey | MNXNVMRNOBMBTD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|