C25H22ClN3O3 — CID 134792424
1'-(6-chloropyridine-3-carbonyl)-5-phenylspiro[3H-1,5-benzoxazepine-2,4'-piperidine]-4-one (PubChem CID 134792424) has the molecular formula C25H22ClN3O3 and a molecular weight of 447.92 g/mol. Its IUPAC name is 1'-(6-chloropyridine-3-carbonyl)-5-phenylspiro[3H-1,5-benzoxazepine-2,4'-piperidine]-4-one.
| Compound Name | 1'-(6-chloropyridine-3-carbonyl)-5-phenylspiro[3H-1,5-benzoxazepine-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 134792424 |
| Molecular Formula | C25H22ClN3O3 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 1'-(6-chloropyridine-3-carbonyl)-5-phenylspiro[3H-1,5-benzoxazepine-2,4'-piperidine]-4-one |
| SMILES | O=C(c1ccc(Cl)nc1)N1CCC2(CC1)CC(=O)N(c1ccccc1)c1ccccc1O2 |
| InChI | InChI=1S/C25H22ClN3O3/c26-22-11-10-18(17-27-22)24(31)28-14-12-25(13-15-28)16-23(30)29(19-6-2-1-3-7-19)20-8-4-5-9-21(20)32-25/h1-11,17H,12-16H2 |
| InChIKey | NWOKUHQQIKWNPE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|