C28H30BBrF2N2O2 — CID 91344247
5-bromo-2-methylpyridine;5-(2,6-difluorophenyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,4-dihydro-2H-pyrrole (PubChem CID 91344247) has the molecular formula C28H30BBrF2N2O2 and a molecular weight of 555.27 g/mol. Its IUPAC name is 5-bromo-2-methylpyridine;5-(2,6-difluorophenyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-bromo-2-methylpyridine;5-(2,6-difluorophenyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 91344247 |
| Molecular Formula | C28H30BBrF2N2O2 |
| Molecular Weight | 555.27 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | 5-bromo-2-methylpyridine;5-(2,6-difluorophenyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,4-dihydro-2H-pyrrole |
| SMILES | CC1(C)OB(c2ccc(C3CCC(c4c(F)cccc4F)=N3)cc2)OC1(C)C.Cc1ccc(Br)cn1 |
| InChI | InChI=1S/C22H24BF2NO2.C6H6BrN/c1-21(2)22(3,4)28-23(27-21)15-10-8-14(9-11-15)18-12-13-19(26-18)20-16(24)6-5-7-17(20)25;1-5-2-3-6(7)4-8-5/h5-11,18H,12-13H2,1-4H3;2-4H,1H3 |
| InChIKey | UHLBVOHLOQGDOB-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.27 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|