C15H14N2O6 — CID 91344865
3-hydroxy-3-[(3-hydroxy-2,5-dioxopyrrolidin-3-yl)-phenylmethyl]pyrrolidine-2,5-dione (PubChem CID 91344865) has the molecular formula C15H14N2O6 and a molecular weight of 318.28 g/mol. Its IUPAC name is 3-hydroxy-3-[(3-hydroxy-2,5-dioxopyrrolidin-3-yl)-phenylmethyl]pyrrolidine-2,5-dione.
| Compound Name | 3-hydroxy-3-[(3-hydroxy-2,5-dioxopyrrolidin-3-yl)-phenylmethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 91344865 |
| Molecular Formula | C15H14N2O6 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 3-hydroxy-3-[(3-hydroxy-2,5-dioxopyrrolidin-3-yl)-phenylmethyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(O)(C(c2ccccc2)C2(O)CC(=O)NC2=O)C(=O)N1 |
| InChI | InChI=1S/C15H14N2O6/c18-9-6-14(22,12(20)16-9)11(8-4-2-1-3-5-8)15(23)7-10(19)17-13(15)21/h1-5,11,22-23H,6-7H2,(H,16,18,20)(H,17,19,21) |
| InChIKey | LOVLNDVZWYZVDN-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|