C48H49F4N13O5 — CID 91345077
1,1-bis[4-[4,6-bis(6-fluoro-3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1,3,5-triazin-2-yl]phenyl]-3-pyridin-3-ylurea (PubChem CID 91345077) has the molecular formula C48H49F4N13O5 and a molecular weight of 964.00 g/mol. Its IUPAC name is 1,1-bis[4-[4,6-bis(6-fluoro-3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1,3,5-triazin-2-yl]phenyl]-3-pyridin-3-ylurea.
| Compound Name | 1,1-bis[4-[4,6-bis(6-fluoro-3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1,3,5-triazin-2-yl]phenyl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 91345077 |
| Molecular Formula | C48H49F4N13O5 |
| Molecular Weight | 964.00 g/mol |
| Exact Mass | 963.39 |
| IUPAC Name | 1,1-bis[4-[4,6-bis(6-fluoro-3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1,3,5-triazin-2-yl]phenyl]-3-pyridin-3-ylurea |
| SMILES | O=C(Nc1cccnc1)N(c1ccc(-c2nc(N3C4COCC3C(F)C4)nc(N3C4COCC3C(F)C4)n2)cc1)c1ccc(-c2nc(N3C4COCC3C(F)C4)nc(N3C4COCC3C(F)C4)n2)cc1 |
| InChI | InChI=1S/C48H49F4N13O5/c49-34-12-30-17-67-21-38(34)62(30)44-55-42(56-45(59-44)63-31-13-35(50)39(63)22-68-18-31)25-3-7-28(8-4-25)61(48(66)54-27-2-1-11-53-16-27)29-9-5-26(6-10-29)43-57-46(64-32-14-36(51)40(64)23-69-19-32)60-47(58-43)65-33-15-37(52)41(65)24-70-20-33/h1-11,16,30-41H,12-15,17-24H2,(H,54,66) |
| InChIKey | PSDNHOMHEVKEEH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 172.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.00 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |