C23H20F3N2O2+ — CID 91345478
2-(2-pyridin-2-ylethyl)-2-[[4-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-2-ium-1-one (PubChem CID 91345478) has the molecular formula C23H20F3N2O2+ and a molecular weight of 413.42 g/mol. Its IUPAC name is 2-(2-pyridin-2-ylethyl)-2-[[4-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-2-ium-1-one.
| Compound Name | 2-(2-pyridin-2-ylethyl)-2-[[4-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-2-ium-1-one |
|---|---|
| PubChem CID | 91345478 |
| Molecular Formula | C23H20F3N2O2+ |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-(2-pyridin-2-ylethyl)-2-[[4-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-2-ium-1-one |
| SMILES | O=C1c2ccccc2C[N+]1(CCc1ccccn1)Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H20F3N2O2/c24-23(25,26)30-20-10-8-17(9-11-20)15-28(14-12-19-6-3-4-13-27-19)16-18-5-1-2-7-21(18)22(28)29/h1-11,13H,12,14-16H2/q+1 |
| InChIKey | QQEFQSXWDWRGSM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|