C26H21F3N4O2 — CID 91559426
N-[2-amino-6-(2-pyridin-2-ylethyl)-3-pyridinyl]-2-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 91559426) has the molecular formula C26H21F3N4O2 and a molecular weight of 478.47 g/mol. Its IUPAC name is N-[2-amino-6-(2-pyridin-2-ylethyl)-3-pyridinyl]-2-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | N-[2-amino-6-(2-pyridin-2-ylethyl)-3-pyridinyl]-2-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 91559426 |
| Molecular Formula | C26H21F3N4O2 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-[2-amino-6-(2-pyridin-2-ylethyl)-3-pyridinyl]-2-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | Nc1nc(CCc2ccccn2)ccc1NC(=O)c1ccccc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H21F3N4O2/c27-26(28,29)35-20-13-8-17(9-14-20)21-6-1-2-7-22(21)25(34)33-23-15-12-19(32-24(23)30)11-10-18-5-3-4-16-31-18/h1-9,12-16H,10-11H2,(H2,30,32)(H,33,34) |
| InChIKey | TYZFZYOEMDIEFT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |