C27H25N3O — CID 10158321
2-(4-methylphenyl)-N-[4-(2-pyridin-2-ylethylamino)phenyl]benzamide (PubChem CID 10158321) has the molecular formula C27H25N3O and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-(4-methylphenyl)-N-[4-(2-pyridin-2-ylethylamino)phenyl]benzamide.
| Compound Name | 2-(4-methylphenyl)-N-[4-(2-pyridin-2-ylethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 10158321 |
| Molecular Formula | C27H25N3O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 2-(4-methylphenyl)-N-[4-(2-pyridin-2-ylethylamino)phenyl]benzamide |
| SMILES | Cc1ccc(-c2ccccc2C(=O)Nc2ccc(NCCc3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C27H25N3O/c1-20-9-11-21(12-10-20)25-7-2-3-8-26(25)27(31)30-24-15-13-23(14-16-24)29-19-17-22-6-4-5-18-28-22/h2-16,18,29H,17,19H2,1H3,(H,30,31) |
| InChIKey | LCOVAVCFFHFTIV-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |