C28H25N3O5S — CID 91545778
[4-[2-[[4-[(1-oxo-3-pyridin-2-ylpropan-2-yl)amino]phenyl]carbamoyl]phenyl]phenyl] methanesulfonate (PubChem CID 91545778) has the molecular formula C28H25N3O5S and a molecular weight of 515.59 g/mol. Its IUPAC name is [4-[2-[[4-[(1-oxo-3-pyridin-2-ylpropan-2-yl)amino]phenyl]carbamoyl]phenyl]phenyl] methanesulfonate.
| Compound Name | [4-[2-[[4-[(1-oxo-3-pyridin-2-ylpropan-2-yl)amino]phenyl]carbamoyl]phenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 91545778 |
| Molecular Formula | C28H25N3O5S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | [4-[2-[[4-[(1-oxo-3-pyridin-2-ylpropan-2-yl)amino]phenyl]carbamoyl]phenyl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(-c2ccccc2C(=O)Nc2ccc(NC(C=O)Cc3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C28H25N3O5S/c1-37(34,35)36-25-15-9-20(10-16-25)26-7-2-3-8-27(26)28(33)31-22-13-11-21(12-14-22)30-24(19-32)18-23-6-4-5-17-29-23/h2-17,19,24,30H,18H2,1H3,(H,31,33) |
| InChIKey | CMVCRIOCFWISCI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|