C22H27ClN3O2+ — CID 9134721
1-[2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl]-N-phenylpiperidin-1-ium-4-carboxamide (PubChem CID 9134721) has the molecular formula C22H27ClN3O2+ and a molecular weight of 400.93 g/mol. Its IUPAC name is 1-[2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl]-N-phenylpiperidin-1-ium-4-carboxamide.
| Compound Name | 1-[2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl]-N-phenylpiperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9134721 |
| Molecular Formula | C22H27ClN3O2+ |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1-[2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl]-N-phenylpiperidin-1-ium-4-carboxamide |
| SMILES | O=C(C[NH+]1CCC(C(=O)Nc2ccccc2)CC1)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H26ClN3O2/c23-19-6-4-5-17(15-19)9-12-24-21(27)16-26-13-10-18(11-14-26)22(28)25-20-7-2-1-3-8-20/h1-8,15,18H,9-14,16H2,(H,24,27)(H,25,28)/p+1 |
| InChIKey | HVPTYGFPFQLGOA-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |