C18H33N — CID 91347644
N-(10-ethyl-5,8,11-trimethyldodeca-5,9-dien-3-yl)methanimine (PubChem CID 91347644) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is N-(10-ethyl-5,8,11-trimethyldodeca-5,9-dien-3-yl)methanimine.
| Compound Name | N-(10-ethyl-5,8,11-trimethyldodeca-5,9-dien-3-yl)methanimine |
|---|---|
| PubChem CID | 91347644 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | N-(10-ethyl-5,8,11-trimethyldodeca-5,9-dien-3-yl)methanimine |
| SMILES | C=NC(CC)CC(C)=CCC(C)C=C(CC)C(C)C |
| InChI | InChI=1S/C18H33N/c1-8-17(14(3)4)12-15(5)10-11-16(6)13-18(9-2)19-7/h11-12,14-15,18H,7-10,13H2,1-6H3 |
| InChIKey | XHDZROWZFRROMF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|