C19H33N — CID 123237410
N-(8,14-dimethylpentadeca-1,6,12-trien-4-yl)ethanimine (PubChem CID 123237410) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is N-(8,14-dimethylpentadeca-1,6,12-trien-4-yl)ethanimine.
| Compound Name | N-(8,14-dimethylpentadeca-1,6,12-trien-4-yl)ethanimine |
|---|---|
| PubChem CID | 123237410 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | N-(8,14-dimethylpentadeca-1,6,12-trien-4-yl)ethanimine |
| SMILES | C=CCC(CC=CC(C)CCCC=CC(C)C)/N=C/C |
| InChI | InChI=1S/C19H33N/c1-6-12-19(20-7-2)16-11-15-18(5)14-10-8-9-13-17(3)4/h6-7,9,11,13,15,17-19H,1,8,10,12,14,16H2,2-5H3/b13-9?,15-11?,20-7+ |
| InChIKey | PYFYCPOXOXTTGQ-OQCIFCFESA-N |
| XLogP | 5.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|