C40H45N3O9 — CID 91349291
tert-butyl 4-[4-[[1-[5-cyano-2-(3-ethoxy-3-oxoprop-1-enyl)phenoxy]-4-oxo-4-phenylmethoxybutan-2-yl]carbamoyl]phenoxy]piperidine-1-carboxylate (PubChem CID 91349291) has the molecular formula C40H45N3O9 and a molecular weight of 711.81 g/mol. Its IUPAC name is tert-butyl 4-[4-[[1-[5-cyano-2-(3-ethoxy-3-oxoprop-1-enyl)phenoxy]-4-oxo-4-phenylmethoxybutan-2-yl]carbamoyl]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[1-[5-cyano-2-(3-ethoxy-3-oxoprop-1-enyl)phenoxy]-4-oxo-4-phenylmethoxybutan-2-yl]carbamoyl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91349291 |
| Molecular Formula | C40H45N3O9 |
| Molecular Weight | 711.81 g/mol |
| Exact Mass | 711.32 |
| IUPAC Name | tert-butyl 4-[4-[[1-[5-cyano-2-(3-ethoxy-3-oxoprop-1-enyl)phenoxy]-4-oxo-4-phenylmethoxybutan-2-yl]carbamoyl]phenoxy]piperidine-1-carboxylate |
| SMILES | CCOC(=O)C=Cc1ccc(C#N)cc1OCC(CC(=O)OCc1ccccc1)NC(=O)c1ccc(OC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C40H45N3O9/c1-5-48-36(44)18-15-30-12-11-29(25-41)23-35(30)49-27-32(24-37(45)50-26-28-9-7-6-8-10-28)42-38(46)31-13-16-33(17-14-31)51-34-19-21-43(22-20-34)39(47)52-40(2,3)4/h6-18,23,32,34H,5,19-22,24,26-27H2,1-4H3,(H,42,46) |
| InChIKey | TYVLDZPMUGKMNV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 153.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.81 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|