C26H30IN3O5 — CID 68830389
tert-butyl 4-[4-[2-(5-cyano-2-iodophenoxy)ethylcarbamoyl]phenoxy]piperidine-1-carboxylate (PubChem CID 68830389) has the molecular formula C26H30IN3O5 and a molecular weight of 591.45 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-(5-cyano-2-iodophenoxy)ethylcarbamoyl]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-(5-cyano-2-iodophenoxy)ethylcarbamoyl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68830389 |
| Molecular Formula | C26H30IN3O5 |
| Molecular Weight | 591.45 g/mol |
| Exact Mass | 591.12 |
| IUPAC Name | tert-butyl 4-[4-[2-(5-cyano-2-iodophenoxy)ethylcarbamoyl]phenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(C(=O)NCCOc3cc(C#N)ccc3I)cc2)CC1 |
| InChI | InChI=1S/C26H30IN3O5/c1-26(2,3)35-25(32)30-13-10-21(11-14-30)34-20-7-5-19(6-8-20)24(31)29-12-15-33-23-16-18(17-28)4-9-22(23)27/h4-9,16,21H,10-15H2,1-3H3,(H,29,31) |
| InChIKey | WBCJTBDKKOEAHH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|