C14H23NO4 — CID 91349596
(1R)-2-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propylidene]cyclopentane-1-carboxylic acid (PubChem CID 91349596) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is (1R)-2-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propylidene]cyclopentane-1-carboxylic acid.
| Compound Name | (1R)-2-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propylidene]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 91349596 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | (1R)-2-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propylidene]cyclopentane-1-carboxylic acid |
| SMILES | C[C@H](C=C1CCC[C@H]1C(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23NO4/c1-9(15-13(18)19-14(2,3)4)8-10-6-5-7-11(10)12(16)17/h8-9,11H,5-7H2,1-4H3,(H,15,18)(H,16,17)/t9-,11-/m1/s1 |
| InChIKey | YJDXRODRFXGUQI-MWLCHTKSSA-N |
| XLogP | 2.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|