C8H3Cl2IOS — CID 91350563
5,7-dichloro-4-iodo-1-benzothiophen-3-ol (PubChem CID 91350563) has the molecular formula C8H3Cl2IOS and a molecular weight of 344.99 g/mol. Its IUPAC name is 5,7-dichloro-4-iodo-1-benzothiophen-3-ol.
| Compound Name | 5,7-dichloro-4-iodo-1-benzothiophen-3-ol |
|---|---|
| PubChem CID | 91350563 |
| Molecular Formula | C8H3Cl2IOS |
| Molecular Weight | 344.99 g/mol |
| Exact Mass | 343.83 |
| IUPAC Name | 5,7-dichloro-4-iodo-1-benzothiophen-3-ol |
| SMILES | Oc1csc2c(Cl)cc(Cl)c(I)c12 |
| InChI | InChI=1S/C8H3Cl2IOS/c9-3-1-4(10)8-6(7(3)11)5(12)2-13-8/h1-2,12H |
| InChIKey | JRSNGKCTZIXEKM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.99 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|