C10H10O2S — CID 130033071
5,7-dimethyl-1-benzothiophene-3,4-diol (PubChem CID 130033071) has the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. Its IUPAC name is 5,7-dimethyl-1-benzothiophene-3,4-diol.
| Compound Name | 5,7-dimethyl-1-benzothiophene-3,4-diol |
|---|---|
| PubChem CID | 130033071 |
| Molecular Formula | C10H10O2S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 5,7-dimethyl-1-benzothiophene-3,4-diol |
| SMILES | Cc1cc(C)c2scc(O)c2c1O |
| InChI | InChI=1S/C10H10O2S/c1-5-3-6(2)10-8(9(5)12)7(11)4-13-10/h3-4,11-12H,1-2H3 |
| InChIKey | ZFVGJBWQPQCBKK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|