C30H35NO5 — CID 91354514
2-[2-[3-[2-[(4-tert-butylphenyl)methyl-ethylamino]-2-oxoethoxy]phenyl]ethoxy]benzoic acid (PubChem CID 91354514) has the molecular formula C30H35NO5 and a molecular weight of 489.61 g/mol. Its IUPAC name is 2-[2-[3-[2-[(4-tert-butylphenyl)methyl-ethylamino]-2-oxoethoxy]phenyl]ethoxy]benzoic acid.
| Compound Name | 2-[2-[3-[2-[(4-tert-butylphenyl)methyl-ethylamino]-2-oxoethoxy]phenyl]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 91354514 |
| Molecular Formula | C30H35NO5 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 2-[2-[3-[2-[(4-tert-butylphenyl)methyl-ethylamino]-2-oxoethoxy]phenyl]ethoxy]benzoic acid |
| SMILES | CCN(Cc1ccc(C(C)(C)C)cc1)C(=O)COc1cccc(CCOc2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C30H35NO5/c1-5-31(20-23-13-15-24(16-14-23)30(2,3)4)28(32)21-36-25-10-8-9-22(19-25)17-18-35-27-12-7-6-11-26(27)29(33)34/h6-16,19H,5,17-18,20-21H2,1-4H3,(H,33,34) |
| InChIKey | UJEFNVBRNPELGU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |