C22H25FN2O3 — CID 91355385
2-[4-[(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)methyl]piperidin-1-yl]-1-(4-fluorophenyl)ethanone (PubChem CID 91355385) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is 2-[4-[(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)methyl]piperidin-1-yl]-1-(4-fluorophenyl)ethanone.
| Compound Name | 2-[4-[(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)methyl]piperidin-1-yl]-1-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 91355385 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-[4-[(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)methyl]piperidin-1-yl]-1-(4-fluorophenyl)ethanone |
| SMILES | O=C(CN1CCC(Cn2c(O)c3c(c2O)CC=CC3)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H25FN2O3/c23-17-7-5-16(6-8-17)20(26)14-24-11-9-15(10-12-24)13-25-21(27)18-3-1-2-4-19(18)22(25)28/h1-2,5-8,15,27-28H,3-4,9-14H2 |
| InChIKey | QDZPFZSECTZWKM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|