C26H28FN3O3S — CID 91355884
2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-5-methylidene-N-[(2-methylsulfonylphenyl)methyl]hept-2-enamide (PubChem CID 91355884) has the molecular formula C26H28FN3O3S and a molecular weight of 481.59 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-5-methylidene-N-[(2-methylsulfonylphenyl)methyl]hept-2-enamide.
| Compound Name | 2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-5-methylidene-N-[(2-methylsulfonylphenyl)methyl]hept-2-enamide |
|---|---|
| PubChem CID | 91355884 |
| Molecular Formula | C26H28FN3O3S |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-5-methylidene-N-[(2-methylsulfonylphenyl)methyl]hept-2-enamide |
| SMILES | C=C(CC)CC=C(C(=O)NCc1ccccc1S(C)(=O)=O)c1cnn(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C26H28FN3O3S/c1-5-18(2)10-15-23(24-17-29-30(19(24)3)22-13-11-21(27)12-14-22)26(31)28-16-20-8-6-7-9-25(20)34(4,32)33/h6-9,11-15,17H,2,5,10,16H2,1,3-4H3,(H,28,31) |
| InChIKey | PPMWUEAUIYRUGE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|