C14H29- — CID 91355965
4-ethyl-5-ethyl-4,5-dimethyloctane (PubChem CID 91355965) has the molecular formula C14H29- and a molecular weight of 197.39 g/mol. Its IUPAC name is 4-ethyl-5-ethyl-4,5-dimethyloctane.
| Compound Name | 4-ethyl-5-ethyl-4,5-dimethyloctane |
|---|---|
| PubChem CID | 91355965 |
| Molecular Formula | C14H29- |
| Molecular Weight | 197.39 g/mol |
| Exact Mass | 197.23 |
| IUPAC Name | 4-ethyl-5-ethyl-4,5-dimethyloctane |
| SMILES | C[CH-]C(C)(CCC)C(C)(CC)CCC |
| InChI | InChI=1S/C14H29/c1-7-11-13(5,9-3)14(6,10-4)12-8-2/h9H,7-8,10-12H2,1-6H3/q-1 |
| InChIKey | DCYHPULMARMTND-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.39 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|