C15H14O5 — CID 91357729
2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid (PubChem CID 91357729) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is 2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid.
| Compound Name | 2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid |
|---|---|
| PubChem CID | 91357729 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid |
| SMILES | CC(=O)CCC(C(=O)O)C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H14O5/c1-8(16)6-7-11(15(19)20)12-13(17)9-4-2-3-5-10(9)14(12)18/h2-5,11-12H,6-7H2,1H3,(H,19,20) |
| InChIKey | IPPLAHPTYQIAEA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|