2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid

C15H14O5 — CID 91357729

IUPAC2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid
SMILESCC(=O)CCC(C(=O)O)C1C(=O)c2ccccc2C1=O
InChIInChI=1S/C15H14O5/c1-8(16)6-7-11(15(19)20)12-13(17)9-4-2-3-5-10(9)14(12)18/h2-5,11-12H,6-7H2,1H3,(H,19,20)
InChIKeyIPPLAHPTYQIAEA-UHFFFAOYSA-N
MW274.27 g/mol
LogP1.75
Rot. Bonds5

About 2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid

2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid (PubChem CID 91357729) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is 2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid.

Molecular Properties

Compound Name2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid
PubChem CID91357729
Molecular FormulaC15H14O5
Molecular Weight274.27 g/mol
Exact Mass274.08
IUPAC Name2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid
SMILESCC(=O)CCC(C(=O)O)C1C(=O)c2ccccc2C1=O
InChIInChI=1S/C15H14O5/c1-8(16)6-7-11(15(19)20)12-13(17)9-4-2-3-5-10(9)14(12)18/h2-5,11-12H,6-7H2,1H3,(H,19,20)
InChIKeyIPPLAHPTYQIAEA-UHFFFAOYSA-N
XLogP1.75
TPSA88.51 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.27
LogP ≤ 51.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid?
The IUPAC name of 2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid (CID 91357729) is 2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid.
What is the SMILES notation for 2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid?
The canonical SMILES for 2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid is CC(=O)CCC(C(=O)O)C1C(=O)c2ccccc2C1=O.
What is the InChIKey of 2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid?
The InChIKey is IPPLAHPTYQIAEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O5/c1-8(16)6-7-11(15(19)20)12-13(17)9-4-2-3-5-10(9)14(12)18/h2-5,11-12H,6-7H2,1H3,(H,19,20).
What are the key properties of 2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid?
2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid has a molecular weight of 274.27 g/mol, XLogP of 1.75, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxoinden-2-yl)-5-oxohexanoic acid is sourced from PubChem (CID 91357729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).