C22H22O3 — CID 793748
2-[(1R)-4,4-dimethyl-3-oxo-1-phenylpentyl]indene-1,3-dione (PubChem CID 793748) has the molecular formula C22H22O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[(1R)-4,4-dimethyl-3-oxo-1-phenylpentyl]indene-1,3-dione.
| Compound Name | 2-[(1R)-4,4-dimethyl-3-oxo-1-phenylpentyl]indene-1,3-dione |
|---|---|
| PubChem CID | 793748 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-[(1R)-4,4-dimethyl-3-oxo-1-phenylpentyl]indene-1,3-dione |
| SMILES | CC(C)(C)C(=O)C[C@@H](c1ccccc1)C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H22O3/c1-22(2,3)18(23)13-17(14-9-5-4-6-10-14)19-20(24)15-11-7-8-12-16(15)21(19)25/h4-12,17,19H,13H2,1-3H3/t17-/m0/s1 |
| InChIKey | HTHXVNNUTNHMIL-KRWDZBQOSA-N |
| XLogP | 4.47 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|