C19H28O2 — CID 134905612
(5S,6S)-2,2,6,8-tetramethyl-5-phenylnonane-3,7-dione (PubChem CID 134905612) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (5S,6S)-2,2,6,8-tetramethyl-5-phenylnonane-3,7-dione.
| Compound Name | (5S,6S)-2,2,6,8-tetramethyl-5-phenylnonane-3,7-dione |
|---|---|
| PubChem CID | 134905612 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (5S,6S)-2,2,6,8-tetramethyl-5-phenylnonane-3,7-dione |
| SMILES | CC(C)C(=O)[C@@H](C)[C@H](CC(=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H28O2/c1-13(2)18(21)14(3)16(12-17(20)19(4,5)6)15-10-8-7-9-11-15/h7-11,13-14,16H,12H2,1-6H3/t14-,16-/m0/s1 |
| InChIKey | PAEMAVRPCFOTAS-HOCLYGCPSA-N |
| XLogP | 4.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |