C19H25F3O2 — CID 101156809
(2R,3S)-2,6,6-trimethyl-1-phenyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]heptane-1,5-dione (PubChem CID 101156809) has the molecular formula C19H25F3O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is (2R,3S)-2,6,6-trimethyl-1-phenyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]heptane-1,5-dione.
| Compound Name | (2R,3S)-2,6,6-trimethyl-1-phenyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]heptane-1,5-dione |
|---|---|
| PubChem CID | 101156809 |
| Molecular Formula | C19H25F3O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (2R,3S)-2,6,6-trimethyl-1-phenyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]heptane-1,5-dione |
| SMILES | C[C@H]([C@@H](CC(=O)C(C)(C)C)[C@@H](C)C(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H25F3O2/c1-12(17(24)14-9-7-6-8-10-14)15(13(2)19(20,21)22)11-16(23)18(3,4)5/h6-10,12-13,15H,11H2,1-5H3/t12-,13-,15+/m1/s1 |
| InChIKey | JRGOJLMYERZPIH-NFAWXSAZSA-N |
| XLogP | 5.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |