C27H41N5OSi — CID 91358046
N'-[1-(1H-benzimidazol-2-yl)-2-(2-trimethylsilylethoxy)ethyl]-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine (PubChem CID 91358046) has the molecular formula C27H41N5OSi and a molecular weight of 479.75 g/mol. Its IUPAC name is N'-[1-(1H-benzimidazol-2-yl)-2-(2-trimethylsilylethoxy)ethyl]-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine.
| Compound Name | N'-[1-(1H-benzimidazol-2-yl)-2-(2-trimethylsilylethoxy)ethyl]-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 91358046 |
| Molecular Formula | C27H41N5OSi |
| Molecular Weight | 479.75 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | N'-[1-(1H-benzimidazol-2-yl)-2-(2-trimethylsilylethoxy)ethyl]-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine |
| SMILES | C[Si](C)(C)CCOCC(c1nc2ccccc2[nH]1)N(CCCCN)C1CCCc2cccnc21 |
| InChI | InChI=1S/C27H41N5OSi/c1-34(2,3)19-18-33-20-25(27-30-22-12-4-5-13-23(22)31-27)32(17-7-6-15-28)24-14-8-10-21-11-9-16-29-26(21)24/h4-5,9,11-13,16,24-25H,6-8,10,14-15,17-20,28H2,1-3H3,(H,30,31) |
| InChIKey | JATLROSAVOGJNZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.75 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|