C14H26O7S — CID 91359699
4-(4-ethyloctan-3-yloxy)-4-oxo-3-sulfobutanoic acid (PubChem CID 91359699) has the molecular formula C14H26O7S and a molecular weight of 338.42 g/mol. Its IUPAC name is 4-(4-ethyloctan-3-yloxy)-4-oxo-3-sulfobutanoic acid.
| Compound Name | 4-(4-ethyloctan-3-yloxy)-4-oxo-3-sulfobutanoic acid |
|---|---|
| PubChem CID | 91359699 |
| Molecular Formula | C14H26O7S |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 4-(4-ethyloctan-3-yloxy)-4-oxo-3-sulfobutanoic acid |
| SMILES | CCCCC(CC)C(CC)OC(=O)C(CC(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C14H26O7S/c1-4-7-8-10(5-2)11(6-3)21-14(17)12(9-13(15)16)22(18,19)20/h10-12H,4-9H2,1-3H3,(H,15,16)(H,18,19,20) |
| InChIKey | AKTVZFJNBZHPJG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|