C31H33F3N2O5S — CID 91360245
N-[3-[3-methyl-2-[(6S)-4-oxo-2-(2-phenylethyl)-6-propyloxan-3-yl]oxiran-2-yl]phenyl]-5-(trifluoromethyl)pyridine-2-sulfonamide (PubChem CID 91360245) has the molecular formula C31H33F3N2O5S and a molecular weight of 602.68 g/mol. Its IUPAC name is N-[3-[3-methyl-2-[(6S)-4-oxo-2-(2-phenylethyl)-6-propyloxan-3-yl]oxiran-2-yl]phenyl]-5-(trifluoromethyl)pyridine-2-sulfonamide.
| Compound Name | N-[3-[3-methyl-2-[(6S)-4-oxo-2-(2-phenylethyl)-6-propyloxan-3-yl]oxiran-2-yl]phenyl]-5-(trifluoromethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 91360245 |
| Molecular Formula | C31H33F3N2O5S |
| Molecular Weight | 602.68 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | N-[3-[3-methyl-2-[(6S)-4-oxo-2-(2-phenylethyl)-6-propyloxan-3-yl]oxiran-2-yl]phenyl]-5-(trifluoromethyl)pyridine-2-sulfonamide |
| SMILES | CCC[C@H]1CC(=O)C(C2(c3cccc(NS(=O)(=O)c4ccc(C(F)(F)F)cn4)c3)OC2C)C(CCc2ccccc2)O1 |
| InChI | InChI=1S/C31H33F3N2O5S/c1-3-8-25-18-26(37)29(27(40-25)15-13-21-9-5-4-6-10-21)30(20(2)41-30)22-11-7-12-24(17-22)36-42(38,39)28-16-14-23(19-35-28)31(32,33)34/h4-7,9-12,14,16-17,19-20,25,27,29,36H,3,8,13,15,18H2,1-2H3/t20?,25-,27?,29?,30?/m0/s1 |
| InChIKey | MMLZMZUUFFEKRG-SJKATPDYSA-N |
| XLogP | 6.29 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.68 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|