C21H21F3N2O3S — CID 130330317
4-hydroxy-2-propyl-5-[[3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylamino]phenyl]methyl]-2,3-dihydropyran-6-one (PubChem CID 130330317) has the molecular formula C21H21F3N2O3S and a molecular weight of 438.47 g/mol. Its IUPAC name is 4-hydroxy-2-propyl-5-[[3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylamino]phenyl]methyl]-2,3-dihydropyran-6-one.
| Compound Name | 4-hydroxy-2-propyl-5-[[3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylamino]phenyl]methyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 130330317 |
| Molecular Formula | C21H21F3N2O3S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 4-hydroxy-2-propyl-5-[[3-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylamino]phenyl]methyl]-2,3-dihydropyran-6-one |
| SMILES | CCCC1CC(O)=C(Cc2cccc(NSc3ccc(C(F)(F)F)cn3)c2)C(=O)O1 |
| InChI | InChI=1S/C21H21F3N2O3S/c1-2-4-16-11-18(27)17(20(28)29-16)10-13-5-3-6-15(9-13)26-30-19-8-7-14(12-25-19)21(22,23)24/h3,5-9,12,16,26-27H,2,4,10-11H2,1H3 |
| InChIKey | JQYHWEAMOIWIEB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|