C33H36BrClN2O4 — CID 91366090
1-[2-[4-bromo-2-(3-methoxy-2-methylphenoxy)-5-methylphenyl]ethyl]-2-[2-[4-chloro-2-(3-methoxy-2-methylphenoxy)phenyl]ethyl]hydrazine (PubChem CID 91366090) has the molecular formula C33H36BrClN2O4 and a molecular weight of 640.02 g/mol. Its IUPAC name is 1-[2-[4-bromo-2-(3-methoxy-2-methylphenoxy)-5-methylphenyl]ethyl]-2-[2-[4-chloro-2-(3-methoxy-2-methylphenoxy)phenyl]ethyl]hydrazine.
| Compound Name | 1-[2-[4-bromo-2-(3-methoxy-2-methylphenoxy)-5-methylphenyl]ethyl]-2-[2-[4-chloro-2-(3-methoxy-2-methylphenoxy)phenyl]ethyl]hydrazine |
|---|---|
| PubChem CID | 91366090 |
| Molecular Formula | C33H36BrClN2O4 |
| Molecular Weight | 640.02 g/mol |
| Exact Mass | 638.15 |
| IUPAC Name | 1-[2-[4-bromo-2-(3-methoxy-2-methylphenoxy)-5-methylphenyl]ethyl]-2-[2-[4-chloro-2-(3-methoxy-2-methylphenoxy)phenyl]ethyl]hydrazine |
| SMILES | COc1cccc(Oc2cc(Cl)ccc2CCNNCCc2cc(C)c(Br)cc2Oc2cccc(OC)c2C)c1C |
| InChI | InChI=1S/C33H36BrClN2O4/c1-21-18-25(33(20-27(21)34)41-31-11-7-9-29(39-5)23(31)3)15-17-37-36-16-14-24-12-13-26(35)19-32(24)40-30-10-6-8-28(38-4)22(30)2/h6-13,18-20,36-37H,14-17H2,1-5H3 |
| InChIKey | MNNSUZWTOSFBKE-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.02 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|