C19H26N2O3 — CID 91371227
tert-butyl 2-oxospiro[1H-indole-3,3'-2,6-dihydropyridine]-1'-carboxylate;ethane (PubChem CID 91371227) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl 2-oxospiro[1H-indole-3,3'-2,6-dihydropyridine]-1'-carboxylate;ethane.
| Compound Name | tert-butyl 2-oxospiro[1H-indole-3,3'-2,6-dihydropyridine]-1'-carboxylate;ethane |
|---|---|
| PubChem CID | 91371227 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | tert-butyl 2-oxospiro[1H-indole-3,3'-2,6-dihydropyridine]-1'-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CC=CC2(C1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C17H20N2O3.C2H6/c1-16(2,3)22-15(21)19-10-6-9-17(11-19)12-7-4-5-8-13(12)18-14(17)20;1-2/h4-9H,10-11H2,1-3H3,(H,18,20);1-2H3 |
| InChIKey | BCHHIJNPARRGBF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|