C18H25BrO3 — CID 91372695
[1-(3-bromophenoxy)-3,3,5,5-tetramethylcyclohexyl] acetate (PubChem CID 91372695) has the molecular formula C18H25BrO3 and a molecular weight of 369.30 g/mol. Its IUPAC name is [1-(3-bromophenoxy)-3,3,5,5-tetramethylcyclohexyl] acetate.
| Compound Name | [1-(3-bromophenoxy)-3,3,5,5-tetramethylcyclohexyl] acetate |
|---|---|
| PubChem CID | 91372695 |
| Molecular Formula | C18H25BrO3 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | [1-(3-bromophenoxy)-3,3,5,5-tetramethylcyclohexyl] acetate |
| SMILES | CC(=O)OC1(Oc2cccc(Br)c2)CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C18H25BrO3/c1-13(20)21-18(22-15-8-6-7-14(19)9-15)11-16(2,3)10-17(4,5)12-18/h6-9H,10-12H2,1-5H3 |
| InChIKey | DADRKNFEFXRNFG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|