C10H21NO2S — CID 91375430
6-methyl-1,1-dioxo-6-propan-2-ylthiepan-2-amine (PubChem CID 91375430) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is 6-methyl-1,1-dioxo-6-propan-2-ylthiepan-2-amine.
| Compound Name | 6-methyl-1,1-dioxo-6-propan-2-ylthiepan-2-amine |
|---|---|
| PubChem CID | 91375430 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 6-methyl-1,1-dioxo-6-propan-2-ylthiepan-2-amine |
| SMILES | CC(C)C1(C)CCCC(N)S(=O)(=O)C1 |
| InChI | InChI=1S/C10H21NO2S/c1-8(2)10(3)6-4-5-9(11)14(12,13)7-10/h8-9H,4-7,11H2,1-3H3 |
| InChIKey | COLONRJQAPFLAA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |