C8H18N8 — CID 91379196
N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 91379196) has the molecular formula C8H18N8 and a molecular weight of 226.29 g/mol. Its IUPAC name is N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 91379196 |
| Molecular Formula | C8H18N8 |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CN(CCN=[N+]=[N-])CCN(C)CCN=[N+]=[N-] |
| InChI | InChI=1S/C8H18N8/c1-15(5-3-11-13-9)7-8-16(2)6-4-12-14-10/h3-8H2,1-2H3 |
| InChIKey | HZNQIRCYKHAZEU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 104.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|