About N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine
N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 91379196) has the molecular formula C8H18N8
and a molecular weight of 226.29 g/mol. Its IUPAC name is N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine |
| PubChem CID | 91379196 |
| Molecular Formula | C8H18N8 |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CN(CCN=[N+]=[N-])CCN(C)CCN=[N+]=[N-] |
| InChI | InChI=1S/C8H18N8/c1-15(5-3-11-13-9)7-8-16(2)6-4-12-14-10/h3-8H2,1-2H3 |
| InChIKey | HZNQIRCYKHAZEU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 104.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine?
The IUPAC name of N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine (CID 91379196) is N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine?
The canonical SMILES for N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine is CN(CCN=[N+]=[N-])CCN(C)CCN=[N+]=[N-].
What is the InChIKey of N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine?
The InChIKey is HZNQIRCYKHAZEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N8/c1-15(5-3-11-13-9)7-8-16(2)6-4-12-14-10/h3-8H2,1-2H3.
What are the key properties of N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine?
N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine has a molecular weight of 226.29 g/mol, XLogP of 1.47, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(2-azidoethyl)-N,N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 91379196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).