C34H36N2O3 — CID 91379209
4-[4-(4-methoxyanilino)phenyl]-N-(5-methoxyhexa-2,4-dien-2-yl)-N-(4-methoxyphenyl)-2-methylaniline (PubChem CID 91379209) has the molecular formula C34H36N2O3 and a molecular weight of 520.67 g/mol. Its IUPAC name is 4-[4-(4-methoxyanilino)phenyl]-N-(5-methoxyhexa-2,4-dien-2-yl)-N-(4-methoxyphenyl)-2-methylaniline.
| Compound Name | 4-[4-(4-methoxyanilino)phenyl]-N-(5-methoxyhexa-2,4-dien-2-yl)-N-(4-methoxyphenyl)-2-methylaniline |
|---|---|
| PubChem CID | 91379209 |
| Molecular Formula | C34H36N2O3 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | 4-[4-(4-methoxyanilino)phenyl]-N-(5-methoxyhexa-2,4-dien-2-yl)-N-(4-methoxyphenyl)-2-methylaniline |
| SMILES | COC(C)=CC=C(C)N(c1ccc(OC)cc1)c1ccc(-c2ccc(Nc3ccc(OC)cc3)cc2)cc1C |
| InChI | InChI=1S/C34H36N2O3/c1-24-23-28(27-9-12-29(13-10-27)35-30-14-18-32(38-5)19-15-30)11-22-34(24)36(25(2)7-8-26(3)37-4)31-16-20-33(39-6)21-17-31/h7-23,35H,1-6H3 |
| InChIKey | SMRWOVZGZOMJJY-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|